C17H20N8O — CID 120880192
1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 120880192) has the molecular formula C17H20N8O and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 120880192 |
| Molecular Formula | C17H20N8O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H20N8O/c1-23-9-8-19-17(23)14-11-18-7-10-24(14)15(26)12-25-21-16(20-22-25)13-5-3-2-4-6-13/h2-6,8-9,14,18H,7,10-12H2,1H3 |
| InChIKey | XFUXCASDMGWRDL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |