C14H26ClN5O2S — CID 120895211
2-(1-methylimidazol-2-yl)-1-(4-methylpiperidin-1-yl)sulfonylpiperazine;hydrochloride (PubChem CID 120895211) has the molecular formula C14H26ClN5O2S and a molecular weight of 363.92 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-1-(4-methylpiperidin-1-yl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2-(1-methylimidazol-2-yl)-1-(4-methylpiperidin-1-yl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120895211 |
| Molecular Formula | C14H26ClN5O2S |
| Molecular Weight | 363.92 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-1-(4-methylpiperidin-1-yl)sulfonylpiperazine;hydrochloride |
| SMILES | CC1CCN(S(=O)(=O)N2CCNCC2c2nccn2C)CC1.Cl |
| InChI | InChI=1S/C14H25N5O2S.ClH/c1-12-3-7-18(8-4-12)22(20,21)19-10-5-15-11-13(19)14-16-6-9-17(14)2;/h6,9,12-13,15H,3-5,7-8,10-11H2,1-2H3;1H |
| InChIKey | WLMHQCKITOETJJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.92 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |