C13H23N5O2S — CID 120894552
2-(1-methylimidazol-2-yl)-1-piperidin-1-ylsulfonylpiperazine (PubChem CID 120894552) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-1-piperidin-1-ylsulfonylpiperazine.
| Compound Name | 2-(1-methylimidazol-2-yl)-1-piperidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 120894552 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-1-piperidin-1-ylsulfonylpiperazine |
| SMILES | Cn1ccnc1C1CNCCN1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H23N5O2S/c1-16-9-6-15-13(16)12-11-14-5-10-18(12)21(19,20)17-7-3-2-4-8-17/h6,9,12,14H,2-5,7-8,10-11H2,1H3 |
| InChIKey | IMLZWVCDKSSNNB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |