About 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride
2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (PubChem CID 120908252) has the molecular formula C16H20Cl3N5
and a molecular weight of 388.73 g/mol. Its IUPAC name is 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
Molecular Properties
| Compound Name | 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| PubChem CID | 120908252 |
| Molecular Formula | C16H20Cl3N5 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.Clc1cccc(-n2cc(CN3CCC4(CCNC4)C3)nn2)c1Cl |
| InChI | InChI=1S/C16H19Cl2N5.ClH/c17-13-2-1-3-14(15(13)18)23-9-12(20-21-23)8-22-7-5-16(11-22)4-6-19-10-16;/h1-3,9,19H,4-8,10-11H2;1H |
| InChIKey | WGQYBUKZEWTAHD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The IUPAC name of 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (CID 120908252) is 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
What is the SMILES notation for 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The canonical SMILES for 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is Cl.Clc1cccc(-n2cc(CN3CCC4(CCNC4)C3)nn2)c1Cl.
What is the InChIKey of 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The InChIKey is WGQYBUKZEWTAHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2N5.ClH/c17-13-2-1-3-14(15(13)18)23-9-12(20-21-23)8-22-7-5-16(11-22)4-6-19-10-16;/h1-3,9,19H,4-8,10-11H2;1H.
What are the key properties of 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride has a molecular weight of 388.73 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is sourced from PubChem (CID 120908252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).