C15H22IN5 — CID 120913487
2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)guanidine;hydroiodide (PubChem CID 120913487) has the molecular formula C15H22IN5 and a molecular weight of 399.28 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913487 |
| Molecular Formula | C15H22IN5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/Cc2cc(C)nn2C)cc1.I |
| InChI | InChI=1S/C15H21N5.HI/c1-4-12-5-7-13(8-6-12)18-15(16)17-10-14-9-11(2)19-20(14)3;/h5-9H,4,10H2,1-3H3,(H3,16,17,18);1H |
| InChIKey | YRVQWZLKJCTKEK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|