C21H29ClN4O — CID 120968337
1-[1-[[2-(pyridin-2-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120968337) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 1-[1-[[2-(pyridin-2-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-[[2-(pyridin-2-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120968337 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[1-[[2-(pyridin-2-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | Cl.c1ccc(COc2ccccc2CN2CCC(N3CCNCC3)C2)nc1 |
| InChI | InChI=1S/C21H28N4O.ClH/c1-2-7-21(26-17-19-6-3-4-9-23-19)18(5-1)15-24-12-8-20(16-24)25-13-10-22-11-14-25;/h1-7,9,20,22H,8,10-17H2;1H |
| InChIKey | FYSDNXNHEWLGBK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |