C16H23N5 — CID 120968620
7-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-1H-indazole (PubChem CID 120968620) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 7-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-1H-indazole.
| Compound Name | 7-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-1H-indazole |
|---|---|
| PubChem CID | 120968620 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 7-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-1H-indazole |
| SMILES | c1cc(CN2CCC(N3CCNCC3)C2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C16H23N5/c1-2-13-10-18-19-16(13)14(3-1)11-20-7-4-15(12-20)21-8-5-17-6-9-21/h1-3,10,15,17H,4-9,11-12H2,(H,18,19) |
| InChIKey | KQNZEVKITGOYRG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |