C23H34ClN5 — CID 120968349
3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-2-piperidin-1-ylquinoline;hydrochloride (PubChem CID 120968349) has the molecular formula C23H34ClN5 and a molecular weight of 416.01 g/mol. Its IUPAC name is 3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-2-piperidin-1-ylquinoline;hydrochloride.
| Compound Name | 3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-2-piperidin-1-ylquinoline;hydrochloride |
|---|---|
| PubChem CID | 120968349 |
| Molecular Formula | C23H34ClN5 |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]-2-piperidin-1-ylquinoline;hydrochloride |
| SMILES | Cl.c1ccc2nc(N3CCCCC3)c(CN3CCC(N4CCNCC4)C3)cc2c1 |
| InChI | InChI=1S/C23H33N5.ClH/c1-4-11-28(12-5-1)23-20(16-19-6-2-3-7-22(19)25-23)17-26-13-8-21(18-26)27-14-9-24-10-15-27;/h2-3,6-7,16,21,24H,1,4-5,8-15,17-18H2;1H |
| InChIKey | LPJBSGOQRAMRIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |