C17H23N3O2 — CID 167919240
2-[1-(1H-indazol-7-ylmethyl)piperidin-4-yl]-2-methylpropanoic acid (PubChem CID 167919240) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[1-(1H-indazol-7-ylmethyl)piperidin-4-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-(1H-indazol-7-ylmethyl)piperidin-4-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 167919240 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[1-(1H-indazol-7-ylmethyl)piperidin-4-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCN(Cc2cccc3cn[nH]c23)CC1 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,16(21)22)14-6-8-20(9-7-14)11-13-5-3-4-12-10-18-19-15(12)13/h3-5,10,14H,6-9,11H2,1-2H3,(H,18,19)(H,21,22) |
| InChIKey | DNAPOISIZFHFSY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |