C16H21NO7S — CID 120968996
1-(5-ethoxycarbonyl-2-methoxyphenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 120968996) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-(5-ethoxycarbonyl-2-methoxyphenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(5-ethoxycarbonyl-2-methoxyphenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120968996 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(5-ethoxycarbonyl-2-methoxyphenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(OC)c(S(=O)(=O)N2CCC(C)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H21NO7S/c1-4-24-14(18)11-5-6-12(23-3)13(9-11)25(21,22)17-8-7-16(2,10-17)15(19)20/h5-6,9H,4,7-8,10H2,1-3H3,(H,19,20) |
| InChIKey | VHPOTGSNHJSVRY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |