C12H9ClN2OS — CID 121001787
10-chloro-4-methyl-[1,4]thiazino[3,2-b]quinolin-3-one (PubChem CID 121001787) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is 10-chloro-4-methyl-[1,4]thiazino[3,2-b]quinolin-3-one.
| Compound Name | 10-chloro-4-methyl-[1,4]thiazino[3,2-b]quinolin-3-one |
|---|---|
| PubChem CID | 121001787 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 10-chloro-4-methyl-[1,4]thiazino[3,2-b]quinolin-3-one |
| SMILES | CN1C(=O)CSc2c1nc1ccccc1c2Cl |
| InChI | InChI=1S/C12H9ClN2OS/c1-15-9(16)6-17-11-10(13)7-4-2-3-5-8(7)14-12(11)15/h2-5H,6H2,1H3 |
| InChIKey | KBNFSPWYXCQCRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |