C16H16N2OS — CID 54329643
9-methyl-6-thia-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),10(18),11,13,15-pentaen-8-one (PubChem CID 54329643) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 9-methyl-6-thia-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),10(18),11,13,15-pentaen-8-one.
| Compound Name | 9-methyl-6-thia-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),10(18),11,13,15-pentaen-8-one |
|---|---|
| PubChem CID | 54329643 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 9-methyl-6-thia-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(17),10(18),11,13,15-pentaen-8-one |
| SMILES | CN1C(=O)CSC2CCCc3nc4ccccc4c1c32 |
| InChI | InChI=1S/C16H16N2OS/c1-18-14(19)9-20-13-8-4-7-12-15(13)16(18)10-5-2-3-6-11(10)17-12/h2-3,5-6,13H,4,7-9H2,1H3 |
| InChIKey | SXKYWRHQMONTHK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |