About tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate
tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate (PubChem CID 121002766) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate.
Analyze tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate?
The IUPAC name of tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate (CID 121002766) is tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate is CC(C)(C)OC(=O)N1C=CO[C@H]1C(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate?
The InChIKey is PHTJNKZSZFADNI-VIFPVBQESA-N. The full InChI is InChI=1S/C12H21NO3/c1-11(2,3)9-13(7-8-15-9)10(14)16-12(4,5)6/h7-9H,1-6H3/t9-/m0/s1.
What are the key properties of tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate?
tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-tert-butyl-2H-1,3-oxazole-3-carboxylate is sourced from PubChem (CID 121002766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).