C12H20O3 — CID 121003740
(2R)-2-[(4R,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propanal (PubChem CID 121003740) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propanal.
| Compound Name | (2R)-2-[(4R,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 121003740 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2R)-2-[(4R,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propanal |
| SMILES | C/C=C/[C@H]1OC(C)O[C@@H]([C@@H](C)C=O)[C@H]1C |
| InChI | InChI=1S/C12H20O3/c1-5-6-11-9(3)12(8(2)7-13)15-10(4)14-11/h5-12H,1-4H3/b6-5+/t8-,9-,10?,11+,12-/m0/s1 |
| InChIKey | ATXWTZSGVUFCFN-ANRIBDDWSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|