C18H30O5 — CID 10853589
[(Z)-3-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate (PubChem CID 10853589) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is [(Z)-3-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-3-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10853589 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | [(Z)-3-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-oxoethyl)-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C/COC(=O)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H](CC=O)[C@@H]1C |
| InChI | InChI=1S/C18H30O5/c1-12(9-11-21-16(20)17(3,4)5)15-13(2)14(8-10-19)22-18(6,7)23-15/h9-10,13-15H,8,11H2,1-7H3/b12-9-/t13-,14-,15-/m0/s1 |
| InChIKey | ISKWSNXDTCRJHS-LLPKPMBTSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|