C21H34O5 — CID 102359447
[(2R,3S,6R,8S,10S)-2-[(2S)-butan-2-yl]-3-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-4-en-10-yl] 2,2-dimethylpropanoate (PubChem CID 102359447) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is [(2R,3S,6R,8S,10S)-2-[(2S)-butan-2-yl]-3-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-4-en-10-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,6R,8S,10S)-2-[(2S)-butan-2-yl]-3-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-4-en-10-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102359447 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [(2R,3S,6R,8S,10S)-2-[(2S)-butan-2-yl]-3-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-4-en-10-yl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](C)[C@H]1O[C@@]2(C=C[C@@H]1C)C[C@@H](OC(=O)C(C)(C)C)C[C@@H](CC=O)O2 |
| InChI | InChI=1S/C21H34O5/c1-7-14(2)18-15(3)8-10-21(26-18)13-17(12-16(25-21)9-11-22)24-19(23)20(4,5)6/h8,10-11,14-18H,7,9,12-13H2,1-6H3/t14-,15-,16+,17-,18+,21-/m0/s1 |
| InChIKey | WIDXKUSXJKDRMO-RDTNQEAYSA-N |
| XLogP | 4.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|