C23H34O6 — CID 46201496
[(3S,5S,6S,7S,11R,13R,15R)-11-ethenyl-6,12,12,15-tetramethyl-9-oxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadec-1(16)-en-5-yl] acetate (PubChem CID 46201496) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is [(3S,5S,6S,7S,11R,13R,15R)-11-ethenyl-6,12,12,15-tetramethyl-9-oxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadec-1(16)-en-5-yl] acetate.
| Compound Name | [(3S,5S,6S,7S,11R,13R,15R)-11-ethenyl-6,12,12,15-tetramethyl-9-oxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadec-1(16)-en-5-yl] acetate |
|---|---|
| PubChem CID | 46201496 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(3S,5S,6S,7S,11R,13R,15R)-11-ethenyl-6,12,12,15-tetramethyl-9-oxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadec-1(16)-en-5-yl] acetate |
| SMILES | C=C[C@H]1OC(=O)C[C@@H]2O[C@H](CC3=C[C@H](C)C[C@@H](O3)C1(C)C)C[C@H](OC(C)=O)[C@H]2C |
| InChI | InChI=1S/C23H34O6/c1-7-20-23(5,6)21-9-13(2)8-16(28-21)10-17-11-18(26-15(4)24)14(3)19(27-17)12-22(25)29-20/h7-8,13-14,17-21H,1,9-12H2,2-6H3/t13-,14+,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | ZAUHFTXJOVOLFE-FILRWYTGSA-N |
| XLogP | 3.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|