C19H30O5 — CID 24885703
ethyl (2E,4E,6S)-6-[(4S,5R,6R)-2,2,5-trimethyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]hepta-2,4-dienoate (PubChem CID 24885703) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is ethyl (2E,4E,6S)-6-[(4S,5R,6R)-2,2,5-trimethyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]hepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6S)-6-[(4S,5R,6R)-2,2,5-trimethyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 24885703 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | ethyl (2E,4E,6S)-6-[(4S,5R,6R)-2,2,5-trimethyl-6-[(2S)-1-oxopropan-2-yl]-1,3-dioxan-4-yl]hepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C=O)[C@@H]1C |
| InChI | InChI=1S/C19H30O5/c1-7-22-16(21)11-9-8-10-13(2)17-15(4)18(14(3)12-20)24-19(5,6)23-17/h8-15,17-18H,7H2,1-6H3/b10-8+,11-9+/t13-,14+,15+,17-,18-/m0/s1 |
| InChIKey | PCXCDLOKCPXIRW-DAXVUHSUSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|