C12H9ClF2O2 — CID 121009300
2-(2-chloro-2,2-difluoroacetyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 121009300) has the molecular formula C12H9ClF2O2 and a molecular weight of 258.65 g/mol. Its IUPAC name is 2-(2-chloro-2,2-difluoroacetyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(2-chloro-2,2-difluoroacetyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 121009300 |
| Molecular Formula | C12H9ClF2O2 |
| Molecular Weight | 258.65 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-(2-chloro-2,2-difluoroacetyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C12H9ClF2O2/c13-12(14,15)11(17)9-6-5-7-3-1-2-4-8(7)10(9)16/h1-4,9H,5-6H2 |
| InChIKey | KQENVNRLDJYKOQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|