C12H23IO4 — CID 121015471
(Z)-2-iodo-1,4-bis(2-methoxypropan-2-yloxy)but-2-ene (PubChem CID 121015471) has the molecular formula C12H23IO4 and a molecular weight of 358.22 g/mol. Its IUPAC name is (Z)-2-iodo-1,4-bis(2-methoxypropan-2-yloxy)but-2-ene.
| Compound Name | (Z)-2-iodo-1,4-bis(2-methoxypropan-2-yloxy)but-2-ene |
|---|---|
| PubChem CID | 121015471 |
| Molecular Formula | C12H23IO4 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (Z)-2-iodo-1,4-bis(2-methoxypropan-2-yloxy)but-2-ene |
| SMILES | COC(C)(C)OC/C=C(\I)COC(C)(C)OC |
| InChI | InChI=1S/C12H23IO4/c1-11(2,14-5)16-8-7-10(13)9-17-12(3,4)15-6/h7H,8-9H2,1-6H3/b10-7- |
| InChIKey | PXWJKZMFBJVVKK-YFHOEESVSA-N |
| XLogP | 3.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|