C12H11N3O2 — CID 121015645
3-cyano-2-oxo-N-phenylpyrrolidine-1-carboxamide (PubChem CID 121015645) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-cyano-2-oxo-N-phenylpyrrolidine-1-carboxamide.
| Compound Name | 3-cyano-2-oxo-N-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 121015645 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-cyano-2-oxo-N-phenylpyrrolidine-1-carboxamide |
| SMILES | N#CC1CCN(C(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C12H11N3O2/c13-8-9-6-7-15(11(9)16)12(17)14-10-4-2-1-3-5-10/h1-5,9H,6-7H2,(H,14,17) |
| InChIKey | IRZJDJPERUWOJZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |