C20H18N4O5 — CID 121062747
N-[4-[2-(furan-2-carbonylamino)ethylcarbamoyl]phenyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 121062747) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[4-[2-(furan-2-carbonylamino)ethylcarbamoyl]phenyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-[2-(furan-2-carbonylamino)ethylcarbamoyl]phenyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121062747 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[4-[2-(furan-2-carbonylamino)ethylcarbamoyl]phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccco1)c1ccc(NC(=O)c2ccc[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H18N4O5/c25-17(22-10-11-23-20(28)16-4-2-12-29-16)13-5-7-14(8-6-13)24-19(27)15-3-1-9-21-18(15)26/h1-9,12H,10-11H2,(H,21,26)(H,22,25)(H,23,28)(H,24,27) |
| InChIKey | QUGAHODUPLPZCH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|