C16H18FN3O2S — CID 1210752
5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 1210752) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1210752 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/SC(=Cc2ccc(N3CCOCC3)c(F)c2)C(=O)N1C |
| InChI | InChI=1S/C16H18FN3O2S/c1-18-16-19(2)15(21)14(23-16)10-11-3-4-13(12(17)9-11)20-5-7-22-8-6-20/h3-4,9-10H,5-8H2,1-2H3/b14-10?,18-16+ |
| InChIKey | NPTDQXSUQZRHQJ-LYOGEXQLSA-N |
| XLogP | 2.19 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|