C19H25N3O5S2 — CID 121155111
4-tert-butyl-N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-3-oxopropyl]benzenesulfonamide (PubChem CID 121155111) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121155111 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-tert-butyl-N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-3-oxopropyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)N2CC(N3C(=O)CSC3=O)C2)cc1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-19(2,3)13-4-6-15(7-5-13)29(26,27)20-9-8-16(23)21-10-14(11-21)22-17(24)12-28-18(22)25/h4-7,14,20H,8-12H2,1-3H3 |
| InChIKey | ZQYQUQXOGHBDRF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|