C18H22N4O2 — CID 121164859
1-phenyl-5-[4-(triazol-2-yl)piperidin-1-yl]pentane-1,5-dione (PubChem CID 121164859) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-phenyl-5-[4-(triazol-2-yl)piperidin-1-yl]pentane-1,5-dione.
| Compound Name | 1-phenyl-5-[4-(triazol-2-yl)piperidin-1-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 121164859 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-phenyl-5-[4-(triazol-2-yl)piperidin-1-yl]pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCC(n2nccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c23-17(15-5-2-1-3-6-15)7-4-8-18(24)21-13-9-16(10-14-21)22-19-11-12-20-22/h1-3,5-6,11-12,16H,4,7-10,13-14H2 |
| InChIKey | NFQUVQCKNDUNJI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |