C18H21N5OS3 — CID 121180643
5-(dithiolan-3-yl)-N-[(6-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methyl]pentanamide (PubChem CID 121180643) has the molecular formula C18H21N5OS3 and a molecular weight of 419.60 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[(6-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[(6-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 121180643 |
| Molecular Formula | C18H21N5OS3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[(6-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCc1nnc2ccc(-c3cccs3)nn12 |
| InChI | InChI=1S/C18H21N5OS3/c24-18(6-2-1-4-13-9-11-26-27-13)19-12-17-21-20-16-8-7-14(22-23(16)17)15-5-3-10-25-15/h3,5,7-8,10,13H,1-2,4,6,9,11-12H2,(H,19,24) |
| InChIKey | KJHWCDJSVARBEZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|