C12H11ClN2S — CID 121205893
4-chloro-2-cyclopropyl-6-(thiophen-2-ylmethyl)pyrimidine (PubChem CID 121205893) has the molecular formula C12H11ClN2S and a molecular weight of 250.75 g/mol. Its IUPAC name is 4-chloro-2-cyclopropyl-6-(thiophen-2-ylmethyl)pyrimidine.
| Compound Name | 4-chloro-2-cyclopropyl-6-(thiophen-2-ylmethyl)pyrimidine |
|---|---|
| PubChem CID | 121205893 |
| Molecular Formula | C12H11ClN2S |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 4-chloro-2-cyclopropyl-6-(thiophen-2-ylmethyl)pyrimidine |
| SMILES | Clc1cc(Cc2cccs2)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H11ClN2S/c13-11-7-9(6-10-2-1-5-16-10)14-12(15-11)8-3-4-8/h1-2,5,7-8H,3-4,6H2 |
| InChIKey | LRVFOMSFWYBWOK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |