About 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile
4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile (PubChem CID 121215728) has the molecular formula C10H7N3O2
and a molecular weight of 201.19 g/mol. Its IUPAC name is 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile |
| PubChem CID | 121215728 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile |
| SMILES | N#Cc1noc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C10H7N3O2/c11-6-9-12-15-10(14)13(9)7-8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | XZYVARRDCKCTPX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile?
The IUPAC name of 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile (CID 121215728) is 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile.
What is the SMILES notation for 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile?
The canonical SMILES for 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile is N#Cc1noc(=O)n1Cc1ccccc1.
What is the InChIKey of 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile?
The InChIKey is XZYVARRDCKCTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O2/c11-6-9-12-15-10(14)13(9)7-8-4-2-1-3-5-8/h1-5H,7H2.
What are the key properties of 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile?
4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile has a molecular weight of 201.19 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile is sourced from PubChem (CID 121215728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).