C10H7N3O2 — CID 121215728
4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile (PubChem CID 121215728) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile.
| Compound Name | 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile |
|---|---|
| PubChem CID | 121215728 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-benzyl-5-oxo-1,2,4-oxadiazole-3-carbonitrile |
| SMILES | N#Cc1noc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C10H7N3O2/c11-6-9-12-15-10(14)13(9)7-8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | XZYVARRDCKCTPX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |