C11H11NO3S — CID 121220753
N-(7-methoxy-2-oxo-3,4-dihydrothiochromen-4-yl)formamide (PubChem CID 121220753) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is N-(7-methoxy-2-oxo-3,4-dihydrothiochromen-4-yl)formamide.
| Compound Name | N-(7-methoxy-2-oxo-3,4-dihydrothiochromen-4-yl)formamide |
|---|---|
| PubChem CID | 121220753 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | N-(7-methoxy-2-oxo-3,4-dihydrothiochromen-4-yl)formamide |
| SMILES | COc1ccc2c(c1)SC(=O)CC2NC=O |
| InChI | InChI=1S/C11H11NO3S/c1-15-7-2-3-8-9(12-6-13)5-11(14)16-10(8)4-7/h2-4,6,9H,5H2,1H3,(H,12,13) |
| InChIKey | ILJVPOFBXQTMHF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|