C14H16N4 — CID 121235735
1-butyl-4-methylpyridin-1-ium;2,2-dicyanoethenylideneazanide (PubChem CID 121235735) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-butyl-4-methylpyridin-1-ium;2,2-dicyanoethenylideneazanide.
| Compound Name | 1-butyl-4-methylpyridin-1-ium;2,2-dicyanoethenylideneazanide |
|---|---|
| PubChem CID | 121235735 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-butyl-4-methylpyridin-1-ium;2,2-dicyanoethenylideneazanide |
| SMILES | CCCC[n+]1ccc(C)cc1.N#CC(=C=[N-])C#N |
| InChI | InChI=1S/C10H16N.C4N3/c1-3-4-7-11-8-5-10(2)6-9-11;5-1-4(2-6)3-7/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1 |
| InChIKey | PZMMDZJTQQXDEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|