C22H24F3N3O2 — CID 121240475
4-methyl-2-pyrrol-1-yl-1-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pentan-1-one (PubChem CID 121240475) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 4-methyl-2-pyrrol-1-yl-1-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pentan-1-one.
| Compound Name | 4-methyl-2-pyrrol-1-yl-1-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 121240475 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-methyl-2-pyrrol-1-yl-1-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pentan-1-one |
| SMILES | CC(C)CC(C(=O)N1CCc2[nH]c3ccc(OC(F)(F)F)cc3c2C1)n1cccc1 |
| InChI | InChI=1S/C22H24F3N3O2/c1-14(2)11-20(27-8-3-4-9-27)21(29)28-10-7-19-17(13-28)16-12-15(30-22(23,24)25)5-6-18(16)26-19/h3-6,8-9,12,14,20,26H,7,10-11,13H2,1-2H3 |
| InChIKey | VUQXVPRUBAMODX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|