C24H25N3O2 — CID 42506990
(2R)-3-(1H-indol-3-yl)-1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpropan-1-one (PubChem CID 42506990) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpropan-1-one.
| Compound Name | (2R)-3-(1H-indol-3-yl)-1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 42506990 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpropan-1-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)[C@H](C)Cc1c[nH]c2ccccc12)CC3 |
| InChI | InChI=1S/C24H25N3O2/c1-15(11-16-13-25-21-6-4-3-5-18(16)21)24(28)27-10-9-23-20(14-27)19-12-17(29-2)7-8-22(19)26-23/h3-8,12-13,15,25-26H,9-11,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | SSBWTIGHLWFFCQ-OAHLLOKOSA-N |
| XLogP | 4.42 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|