C40H79N3 — CID 121247837
4-[1,10-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl)decyl]-2,2-dimethyl-6-propan-2-ylpiperidine (PubChem CID 121247837) has the molecular formula C40H79N3 and a molecular weight of 602.09 g/mol. Its IUPAC name is 4-[1,10-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl)decyl]-2,2-dimethyl-6-propan-2-ylpiperidine.
| Compound Name | 4-[1,10-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl)decyl]-2,2-dimethyl-6-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 121247837 |
| Molecular Formula | C40H79N3 |
| Molecular Weight | 602.09 g/mol |
| Exact Mass | 601.63 |
| IUPAC Name | 4-[1,10-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl)decyl]-2,2-dimethyl-6-propan-2-ylpiperidine |
| SMILES | CC(C)C1CC(CCCCCCCCCC(C2CC(C(C)C)NC(C)(C)C2)C2CC(C(C)C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C40H79N3/c1-28(2)35-22-31(25-38(7,8)41-35)20-18-16-14-13-15-17-19-21-34(32-23-36(29(3)4)42-39(9,10)26-32)33-24-37(30(5)6)43-40(11,12)27-33/h28-37,41-43H,13-27H2,1-12H3 |
| InChIKey | YRQLUKGDIIWZIO-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.09 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|