C22H29N3O6 — CID 121255931
tert-butyl N-[(2R)-1-[2-formyl-5-methoxy-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 121255931) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-formyl-5-methoxy-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-formyl-5-methoxy-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 121255931 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-formyl-5-methoxy-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | COc1cc(NC(=O)[C@@H](CC(C)C)NC(=O)OC(C)(C)C)c(C=O)cc1-c1cnco1 |
| InChI | InChI=1S/C22H29N3O6/c1-13(2)7-17(25-21(28)31-22(3,4)5)20(27)24-16-9-18(29-6)15(8-14(16)11-26)19-10-23-12-30-19/h8-13,17H,7H2,1-6H3,(H,24,27)(H,25,28)/t17-/m1/s1 |
| InChIKey | IJTDHESENFJHRC-QGZVFWFLSA-N |
| XLogP | 4.04 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|