About [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate
[6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate (PubChem CID 121263905) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate.
Molecular Properties
| Compound Name | [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate |
| PubChem CID | 121263905 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC=C(C)CC1CO |
| InChI | InChI=1S/C11H16O3/c1-8-3-4-10(7-14-9(2)13)11(5-8)6-12/h3-4,11-12H,5-7H2,1-2H3 |
| InChIKey | KEBQJBXVMOAWMI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate?
The IUPAC name of [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate (CID 121263905) is [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate.
What is the SMILES notation for [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate?
The canonical SMILES for [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate is CC(=O)OCC1=CC=C(C)CC1CO.
What is the InChIKey of [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate?
The InChIKey is KEBQJBXVMOAWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-8-3-4-10(7-14-9(2)13)11(5-8)6-12/h3-4,11-12H,5-7H2,1-2H3.
What are the key properties of [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate?
[6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate has a molecular weight of 196.25 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-yl]methyl acetate is sourced from PubChem (CID 121263905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).