C24H27N5O — CID 121278122
(4R)-4-methyl-6-[(4R)-4-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 121278122) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is (4R)-4-methyl-6-[(4R)-4-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-4-methyl-6-[(4R)-4-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121278122 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (4R)-4-methyl-6-[(4R)-4-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C[C@@H]1CC(=O)Nc2cccc(N3CC[C@@H](C)c4cc(-c5cnn(C)c5)ccc43)c2N1 |
| InChI | InChI=1S/C24H27N5O/c1-15-9-10-29(21-8-7-17(12-19(15)21)18-13-25-28(3)14-18)22-6-4-5-20-24(22)26-16(2)11-23(30)27-20/h4-8,12-16,26H,9-11H2,1-3H3,(H,27,30)/t15-,16-/m1/s1 |
| InChIKey | WYXPDZQFPFWNOI-HZPDHXFCSA-N |
| XLogP | 4.88 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |