C13H16N2S2 — CID 121284343
N-thieno[3,4-b]pyridin-5-ylsulfanylcyclohexanamine (PubChem CID 121284343) has the molecular formula C13H16N2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-thieno[3,4-b]pyridin-5-ylsulfanylcyclohexanamine.
| Compound Name | N-thieno[3,4-b]pyridin-5-ylsulfanylcyclohexanamine |
|---|---|
| PubChem CID | 121284343 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-thieno[3,4-b]pyridin-5-ylsulfanylcyclohexanamine |
| SMILES | c1cnc2csc(SNC3CCCCC3)c2c1 |
| InChI | InChI=1S/C13H16N2S2/c1-2-5-10(6-3-1)15-17-13-11-7-4-8-14-12(11)9-16-13/h4,7-10,15H,1-3,5-6H2 |
| InChIKey | XEBMVODRVGFLBJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|