C8H16N6O4S4 — CID 121284666
(3R)-3-azido-4-[[(2R)-2-azido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid (PubChem CID 121284666) has the molecular formula C8H16N6O4S4 and a molecular weight of 388.52 g/mol. Its IUPAC name is (3R)-3-azido-4-[[(2R)-2-azido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid.
| Compound Name | (3R)-3-azido-4-[[(2R)-2-azido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 121284666 |
| Molecular Formula | C8H16N6O4S4 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | (3R)-3-azido-4-[[(2R)-2-azido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
| SMILES | [N-]=[N+]=N[C@H](CCS(=O)O)CSSC[C@@H](CCS(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H16N6O4S4/c9-13-11-7(1-3-21(15)16)5-19-20-6-8(12-14-10)2-4-22(17)18/h7-8H,1-6H2,(H,15,16)(H,17,18)/t7-,8-/m1/s1 |
| InChIKey | JJSDLWYIMGNTHJ-HTQZYQBOSA-N |
| XLogP | 2.95 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|