C8H18N8O4S4 — CID 130358069
(2R,3R)-3-amino-4-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]-2-azidobutane-1-sulfinic acid (PubChem CID 130358069) has the molecular formula C8H18N8O4S4 and a molecular weight of 418.55 g/mol. Its IUPAC name is (2R,3R)-3-amino-4-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]-2-azidobutane-1-sulfinic acid.
| Compound Name | (2R,3R)-3-amino-4-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]-2-azidobutane-1-sulfinic acid |
|---|---|
| PubChem CID | 130358069 |
| Molecular Formula | C8H18N8O4S4 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | (2R,3R)-3-amino-4-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]-2-azidobutane-1-sulfinic acid |
| SMILES | [N-]=[N+]=N[C@@H](CS(=O)O)[C@@H](N)CSSC[C@H](N=[N+]=[N-])[C@@H](N)CS(=O)O |
| InChI | InChI=1S/C8H18N8O4S4/c9-5(8(14-16-12)4-24(19)20)1-21-22-2-7(13-15-11)6(10)3-23(17)18/h5-8H,1-4,9-10H2,(H,17,18)(H,19,20)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | PWXWJVKNHFSWSX-XAMCCFCMSA-N |
| XLogP | 0.82 |
| TPSA | 224.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|