C10H16N12Na2O4S6 — CID 140807799
disodium;(2S,3S)-2,3-diazido-4-[2-[[(2S,3S)-2,3-diazido-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate (PubChem CID 140807799) has the molecular formula C10H16N12Na2O4S6 and a molecular weight of 606.70 g/mol. Its IUPAC name is disodium;(2S,3S)-2,3-diazido-4-[2-[[(2S,3S)-2,3-diazido-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate.
| Compound Name | disodium;(2S,3S)-2,3-diazido-4-[2-[[(2S,3S)-2,3-diazido-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate |
|---|---|
| PubChem CID | 140807799 |
| Molecular Formula | C10H16N12Na2O4S6 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 605.95 |
| IUPAC Name | disodium;(2S,3S)-2,3-diazido-4-[2-[[(2S,3S)-2,3-diazido-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate |
| SMILES | [N-]=[N+]=N[C@H](CSSCCSSC[C@@H](N=[N+]=[N-])[C@@H](CS(=O)[O-])N=[N+]=[N-])[C@@H](CS(=O)[O-])N=[N+]=[N-].[Na+].[Na+] |
| InChI | InChI=1S/C10H18N12O4S6.2Na/c11-19-15-7(9(17-21-13)5-31(23)24)3-29-27-1-2-28-30-4-8(16-20-12)10(18-22-14)6-32(25)26;;/h7-10H,1-6H2,(H,23,24)(H,25,26);;/q;2*+1/p-2/t7-,8-,9-,10-;;/m1../s1 |
| InChIKey | FFBQJMMPHRSNJL-XYSQQLOGSA-L |
| XLogP | -1.77 |
| TPSA | 275.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|