C8H18N2Na2O4S4 — CID 140807842
disodium;(2R)-2-amino-4-[[(3R)-3-amino-4-sulfinatobutyl]disulfanyl]butane-1-sulfinate (PubChem CID 140807842) has the molecular formula C8H18N2Na2O4S4 and a molecular weight of 380.49 g/mol. Its IUPAC name is disodium;(2R)-2-amino-4-[[(3R)-3-amino-4-sulfinatobutyl]disulfanyl]butane-1-sulfinate.
| Compound Name | disodium;(2R)-2-amino-4-[[(3R)-3-amino-4-sulfinatobutyl]disulfanyl]butane-1-sulfinate |
|---|---|
| PubChem CID | 140807842 |
| Molecular Formula | C8H18N2Na2O4S4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | disodium;(2R)-2-amino-4-[[(3R)-3-amino-4-sulfinatobutyl]disulfanyl]butane-1-sulfinate |
| SMILES | N[C@H](CCSSCC[C@@H](N)CS(=O)[O-])CS(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H20N2O4S4.2Na/c9-7(5-17(11)12)1-3-15-16-4-2-8(10)6-18(13)14;;/h7-8H,1-6,9-10H2,(H,11,12)(H,13,14);;/q;2*+1/p-2/t7-,8-;;/m1../s1 |
| InChIKey | SDPSAPQOLOXRTK-RHJRFJOKSA-L |
| XLogP | -6.43 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|