C10H22N2Na2O4S6 — CID 140807817
disodium;(3S)-3-amino-4-[2-[[(2S)-2-amino-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate (PubChem CID 140807817) has the molecular formula C10H22N2Na2O4S6 and a molecular weight of 472.68 g/mol. Its IUPAC name is disodium;(3S)-3-amino-4-[2-[[(2S)-2-amino-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate.
| Compound Name | disodium;(3S)-3-amino-4-[2-[[(2S)-2-amino-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate |
|---|---|
| PubChem CID | 140807817 |
| Molecular Formula | C10H22N2Na2O4S6 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | disodium;(3S)-3-amino-4-[2-[[(2S)-2-amino-4-sulfinatobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinate |
| SMILES | N[C@@H](CCS(=O)[O-])CSSCCSSC[C@@H](N)CCS(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H24N2O4S6.2Na/c11-9(1-5-21(13)14)7-19-17-3-4-18-20-8-10(12)2-6-22(15)16;;/h9-10H,1-8,11-12H2,(H,13,14)(H,15,16);;/q;2*+1/p-2/t9-,10-;;/m0../s1 |
| InChIKey | GAXOOXRHCGRHRB-BZDVOYDHSA-L |
| XLogP | -5.05 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|