C8H17Na2O8S4+ — CID 157191925
disodium;(2S,3S)-4-[[(2S,3S)-2,3-dihydroxy-4-sulfinobutyl]disulfanyl]-2,3-dihydroxybutane-1-sulfinate (PubChem CID 157191925) has the molecular formula C8H17Na2O8S4+ and a molecular weight of 415.46 g/mol. Its IUPAC name is disodium;(2S,3S)-4-[[(2S,3S)-2,3-dihydroxy-4-sulfinobutyl]disulfanyl]-2,3-dihydroxybutane-1-sulfinate.
| Compound Name | disodium;(2S,3S)-4-[[(2S,3S)-2,3-dihydroxy-4-sulfinobutyl]disulfanyl]-2,3-dihydroxybutane-1-sulfinate |
|---|---|
| PubChem CID | 157191925 |
| Molecular Formula | C8H17Na2O8S4+ |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | disodium;(2S,3S)-4-[[(2S,3S)-2,3-dihydroxy-4-sulfinobutyl]disulfanyl]-2,3-dihydroxybutane-1-sulfinate |
| SMILES | O=S([O-])C[C@@H](O)[C@H](O)CSSC[C@@H](O)[C@H](O)CS(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C8H18O8S4.2Na/c9-5(7(11)3-19(13)14)1-17-18-2-6(10)8(12)4-20(15)16;;/h5-12H,1-4H2,(H,13,14)(H,15,16);;/q;2*+1/p-1/t5-,6-,7-,8-;;/m1../s1 |
| InChIKey | XBEDZHWZWGPMQC-SWVWMVOQSA-M |
| XLogP | -8.08 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | -8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|