C10H19N2O4S3- — CID 54568288
(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanyl-1-oxobutane-1-sulfinate (PubChem CID 54568288) has the molecular formula C10H19N2O4S3- and a molecular weight of 327.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanyl-1-oxobutane-1-sulfinate.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanyl-1-oxobutane-1-sulfinate |
|---|---|
| PubChem CID | 54568288 |
| Molecular Formula | C10H19N2O4S3- |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanyl-1-oxobutane-1-sulfinate |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CCSC)C(=O)S(=O)[O-] |
| InChI | InChI=1S/C10H20N2O4S3/c1-17-5-3-7(11)9(13)12-8(4-6-18-2)10(14)19(15)16/h7-8H,3-6,11H2,1-2H3,(H,12,13)(H,15,16)/p-1/t7-,8-/m0/s1 |
| InChIKey | GMXVESIIACFJLZ-YUMQZZPRSA-M |
| XLogP | -0.29 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|