C10H22N8O4S6 — CID 130358081
(2R,3R)-3-amino-4-[2-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]-2-azidobutane-1-sulfinic acid (PubChem CID 130358081) has the molecular formula C10H22N8O4S6 and a molecular weight of 510.74 g/mol. Its IUPAC name is (2R,3R)-3-amino-4-[2-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]-2-azidobutane-1-sulfinic acid.
| Compound Name | (2R,3R)-3-amino-4-[2-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]-2-azidobutane-1-sulfinic acid |
|---|---|
| PubChem CID | 130358081 |
| Molecular Formula | C10H22N8O4S6 |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | (2R,3R)-3-amino-4-[2-[[(2R,3R)-3-amino-2-azido-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]-2-azidobutane-1-sulfinic acid |
| SMILES | [N-]=[N+]=N[C@@H](CS(=O)O)[C@@H](N)CSSCCSSC[C@H](N=[N+]=[N-])[C@@H](N)CS(=O)O |
| InChI | InChI=1S/C10H22N8O4S6/c11-7(10(16-18-14)6-28(21)22)3-25-23-1-2-24-26-4-9(15-17-13)8(12)5-27(19)20/h7-10H,1-6,11-12H2,(H,19,20)(H,21,22)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | XEVOHTRIDWAZGE-XKNYDFJKSA-N |
| XLogP | 2.20 |
| TPSA | 224.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|