C16H34O4S6 — CID 174363063
2-[1-[2-[(2,3-dimethyl-4-sulfinobutyl)disulfanyl]ethyldisulfanyl]propan-2-yl]pentane-1-sulfinic acid (PubChem CID 174363063) has the molecular formula C16H34O4S6 and a molecular weight of 482.85 g/mol. Its IUPAC name is 2-[1-[2-[(2,3-dimethyl-4-sulfinobutyl)disulfanyl]ethyldisulfanyl]propan-2-yl]pentane-1-sulfinic acid.
| Compound Name | 2-[1-[2-[(2,3-dimethyl-4-sulfinobutyl)disulfanyl]ethyldisulfanyl]propan-2-yl]pentane-1-sulfinic acid |
|---|---|
| PubChem CID | 174363063 |
| Molecular Formula | C16H34O4S6 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[1-[2-[(2,3-dimethyl-4-sulfinobutyl)disulfanyl]ethyldisulfanyl]propan-2-yl]pentane-1-sulfinic acid |
| SMILES | CCCC(CS(=O)O)C(C)CSSCCSSCC(C)C(C)CS(=O)O |
| InChI | InChI=1S/C16H34O4S6/c1-5-6-16(12-26(19)20)14(3)10-24-22-8-7-21-23-9-13(2)15(4)11-25(17)18/h13-16H,5-12H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | KXEPVZSQPPVBAH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|