C8H16O2S — CID 161372702
(2S,3S)-3-ethyl-2-methylpent-4-ene-1-sulfinic acid (PubChem CID 161372702) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is (2S,3S)-3-ethyl-2-methylpent-4-ene-1-sulfinic acid.
| Compound Name | (2S,3S)-3-ethyl-2-methylpent-4-ene-1-sulfinic acid |
|---|---|
| PubChem CID | 161372702 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (2S,3S)-3-ethyl-2-methylpent-4-ene-1-sulfinic acid |
| SMILES | C=C[C@H](CC)[C@H](C)CS(=O)O |
| InChI | InChI=1S/C8H16O2S/c1-4-8(5-2)7(3)6-11(9)10/h4,7-8H,1,5-6H2,2-3H3,(H,9,10)/t7-,8-/m1/s1 |
| InChIKey | JZIMJQDGFCSGMX-HTQZYQBOSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|