C13H17NO2S2 — CID 121291099
2-hexylimino-1,3-benzodithiole-4,7-diol (PubChem CID 121291099) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-hexylimino-1,3-benzodithiole-4,7-diol.
| Compound Name | 2-hexylimino-1,3-benzodithiole-4,7-diol |
|---|---|
| PubChem CID | 121291099 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-hexylimino-1,3-benzodithiole-4,7-diol |
| SMILES | CCCCCCN=c1sc2c(O)ccc(O)c2s1 |
| InChI | InChI=1S/C13H17NO2S2/c1-2-3-4-5-8-14-13-17-11-9(15)6-7-10(16)12(11)18-13/h6-7,15-16H,2-5,8H2,1H3 |
| InChIKey | DYGMGYKAHUNIJE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|