C28H36F3NO3 — CID 121321598
2,2-dimethyl-5-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-amine (PubChem CID 121321598) has the molecular formula C28H36F3NO3 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2,2-dimethyl-5-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-5-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 121321598 |
| Molecular Formula | C28H36F3NO3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 2,2-dimethyl-5-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(N)(CCc2ccc(OCCCC3CCCc4ccccc43)c(C(F)(F)F)c2)CO1 |
| InChI | InChI=1S/C28H36F3NO3/c1-26(2)34-18-27(32,19-35-26)15-14-20-12-13-25(24(17-20)28(29,30)31)33-16-6-10-22-9-5-8-21-7-3-4-11-23(21)22/h3-4,7,11-13,17,22H,5-6,8-10,14-16,18-19,32H2,1-2H3 |
| InChIKey | IWMVYVKVCDIAKG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|