C35H49F3NO6P — CID 59407831
ditert-butyl [2-methyl-4-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 59407831) has the molecular formula C35H49F3NO6P and a molecular weight of 667.75 g/mol. Its IUPAC name is ditert-butyl [2-methyl-4-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [2-methyl-4-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 59407831 |
| Molecular Formula | C35H49F3NO6P |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | ditert-butyl [2-methyl-4-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CC1=NC(CCc2ccc(OCCCC3CCCc4ccccc43)c(C(F)(F)F)c2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C35H49F3NO6P/c1-25-39-34(23-42-25,24-43-46(40,44-32(2,3)4)45-33(5,6)7)20-19-26-17-18-31(30(22-26)35(36,37)38)41-21-11-15-28-14-10-13-27-12-8-9-16-29(27)28/h8-9,12,16-18,22,28H,10-11,13-15,19-21,23-24H2,1-7H3 |
| InChIKey | WKPYHKWWBYTQHI-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|